Difference between revisions of "UG1PUT"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9758 CPD-9758] == * smiles: ** CC(=CCCC(=CCOC(C)=O)C)C * inchi key: ** InChIKey=HIGQPQRQIQD...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6012-1 PWY-6012-1] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9758 CPD-9758] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
** CC(=CCCC(=CCOC(C)=O)C)C
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
* inchi key:
 +
** InChIKey=HIGQPQRQIQDZMP-DHZHZOJOSA-N
 
* common name:
 
* common name:
−
** acyl carrier protein activation
+
** geranyl acetate
 +
* molecular weight:
 +
** 196.289   
 
* Synonym(s):
 
* Synonym(s):
−
** [acp] metabolism
+
** geraniol acetate
−
** ACP metabolism
+
** neryl acetate
 +
** geranyl acetate, cis-
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''1''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[HOLO-ACP-SYNTH-RXN]]
+
* [[RXN-9192]]
−
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-2157}}
+
* PUBCHEM:
−
{{#set: taxonomic range=TAX-2759}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1549026 1549026]
−
{{#set: common name=acyl carrier protein activation}}
+
* CHEMSPIDER:
−
{{#set: common name=[acp] metabolism|ACP metabolism}}
+
** [http://www.chemspider.com/Chemical-Structure.1266019.html 1266019]
−
{{#set: reaction found=1}}
+
* CHEBI:
−
{{#set: reaction not found=1}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=5331 5331]
−
{{#set: completion rate=100.0}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C09861 C09861]
 +
* HMDB : HMDB35157
 +
{{#set: smiles=CC(=CCCC(=CCOC(C)=O)C)C}}
 +
{{#set: inchi key=InChIKey=HIGQPQRQIQDZMP-DHZHZOJOSA-N}}
 +
{{#set: common name=geranyl acetate}}
 +
{{#set: molecular weight=196.289    }}
 +
{{#set: common name=geraniol acetate|neryl acetate|geranyl acetate, cis-}}
 +
{{#set: produced by=RXN-9192}}

Revision as of 18:29, 18 March 2018

Metabolite CPD-9758

  • smiles:
    • CC(=CCCC(=CCOC(C)=O)C)C
  • inchi key:
    • InChIKey=HIGQPQRQIQDZMP-DHZHZOJOSA-N
  • common name:
    • geranyl acetate
  • molecular weight:
    • 196.289
  • Synonym(s):
    • geraniol acetate
    • neryl acetate
    • geranyl acetate, cis-

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=UG1PUT&oldid=24759"