Difference between revisions of "Tiso gene 3513"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9758 CPD-9758] == * smiles: ** CC(=CCCC(=CCOC(C)=O)C)C * inchi key: ** InChIKey=HIGQPQRQIQD...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5756 PWY-5756] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-31...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9758 CPD-9758] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5756 PWY-5756] ==
−
* smiles:
+
* taxonomic range:
−
** CC(=CCCC(=CCOC(C)=O)C)C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193]
−
* inchi key:
+
−
** InChIKey=HIGQPQRQIQDZMP-DHZHZOJOSA-N
+
 
* common name:
 
* common name:
−
** geranyl acetate
+
** saponin biosynthesis II
−
* molecular weight:
+
−
** 196.289   
+
 
* Synonym(s):
 
* Synonym(s):
−
** geraniol acetate
+
** oleanolate glucuronide triterpene saponin biosynthesis
−
** neryl acetate
+
** oleanolate glucuronide biosynthesis
−
** geranyl acetate, cis-
+
** triterpene saponin biosynthesis II
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''8''' reactions in the full pathway
−
* [[RXN-9192]]
+
* [[RXN-9000]]
−
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_14140]]
 +
*** [[Tiso_gene_14141]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9001 RXN-9001]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9002 RXN-9002]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9004 RXN-9004]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9005 RXN-9005]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9006 RXN-9006]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9007 RXN-9007]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9008 RXN-9008]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-3193}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1549026 1549026]
+
{{#set: common name=saponin biosynthesis II}}
−
* CHEMSPIDER:
+
{{#set: common name=oleanolate glucuronide triterpene saponin biosynthesis|oleanolate glucuronide biosynthesis|triterpene saponin biosynthesis II}}
−
** [http://www.chemspider.com/Chemical-Structure.1266019.html 1266019]
+
{{#set: reaction found=1}}
−
* CHEBI:
+
{{#set: total reaction=8}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=5331 5331]
+
{{#set: completion rate=13.0}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C09861 C09861]
+
−
* HMDB : HMDB35157
+
−
{{#set: smiles=CC(=CCCC(=CCOC(C)=O)C)C}}
+
−
{{#set: inchi key=InChIKey=HIGQPQRQIQDZMP-DHZHZOJOSA-N}}
+
−
{{#set: common name=geranyl acetate}}
+
−
{{#set: molecular weight=196.289    }}
+
−
{{#set: common name=geraniol acetate|neryl acetate|geranyl acetate, cis-}}
+
−
{{#set: produced by=RXN-9192}}
+

Revision as of 18:29, 18 March 2018

Pathway PWY-5756

  • taxonomic range:
  • common name:
    • saponin biosynthesis II
  • Synonym(s):
    • oleanolate glucuronide triterpene saponin biosynthesis
    • oleanolate glucuronide biosynthesis
    • triterpene saponin biosynthesis II

Reaction(s) found

1 reactions found over 8 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_3513&oldid=24809"