Difference between revisions of "BSUBPOLYAMSYN-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE SHIKIMATE] == * smiles: ** C1(=C(CC(C(O)C(O)1)O)C(=O)[O-]) * inchi key: ** InChIKey=J...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6498 PWY-6498] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6498 PWY-6498] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | * | + | |
* common name: | * common name: | ||
| − | ** | + | ** eumelanin biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** melanochrome biosynthesis |
| − | ** | + | ** melanogenesis |
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''1''' reactions found over '''6''' reactions in the full pathway |
| − | + | * [[RXN-11403]] | |
| − | * [[ | + | ** 0 associated gene: |
| − | == Reaction(s) | + | ** 1 reconstruction source(s) associated: |
| − | * [[ | + | *** [[annotation-in-silico_annotation]] |
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=DOPACHROME-DELTA-ISOMERASE-RXN DOPACHROME-DELTA-ISOMERASE-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11404 RXN-11404] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11406 RXN-11406] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11408 RXN-11408] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11444 RXN-11444] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=eumelanin biosynthesis}} | |
| − | + | {{#set: common name=melanochrome biosynthesis|melanogenesis}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=6}} | |
| − | + | {{#set: completion rate=17.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 18:30, 18 March 2018
Pathway PWY-6498
- taxonomic range:
- common name:
- eumelanin biosynthesis
- Synonym(s):
- melanochrome biosynthesis
- melanogenesis
Reaction(s) found
1 reactions found over 6 reactions in the full pathway
- RXN-11403
- 0 associated gene:
- 1 reconstruction source(s) associated:
