Difference between revisions of "Tiso gene 8584"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOPENICILLIN-N ISOPENICILLIN-N] == * smiles: ** CC1(C)(S[CH]2(C(C(=O)N(C(C(=O)[O-])1)2)NC(=O)C...") |
|||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOPENICILLIN-N ISOPENICILLIN-N] == |
− | * | + | * smiles: |
− | ** [ | + | ** CC1(C)(S[CH]2(C(C(=O)N(C(C(=O)[O-])1)2)NC(=O)CCCC([N+])C(=O)[O-])) |
− | ** | + | * inchi key: |
+ | ** InChIKey=MIFYHUACUWQUKT-GTQWGBSQSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** isopenicillin N |
+ | * molecular weight: | ||
+ | ** 358.388 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | * [[ | + | * [[1.21.3.1-RXN]] |
− | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244809 25244809] | |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58399 58399] |
− | {{#set: | + | * METABOLIGHTS : MTBLC58399 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05557 C05557] |
+ | {{#set: smiles=CC1(C)(S[CH]2(C(C(=O)N(C(C(=O)[O-])1)2)NC(=O)CCCC([N+])C(=O)[O-]))}} | ||
+ | {{#set: inchi key=InChIKey=MIFYHUACUWQUKT-GTQWGBSQSA-M}} | ||
+ | {{#set: common name=isopenicillin N}} | ||
+ | {{#set: molecular weight=358.388 }} | ||
+ | {{#set: produced by=1.21.3.1-RXN}} |
Revision as of 19:30, 18 March 2018
Contents
Metabolite ISOPENICILLIN-N
- smiles:
- CC1(C)(S[CH]2(C(C(=O)N(C(C(=O)[O-])1)2)NC(=O)CCCC([N+])C(=O)[O-]))
- inchi key:
- InChIKey=MIFYHUACUWQUKT-GTQWGBSQSA-M
- common name:
- isopenicillin N
- molecular weight:
- 358.388
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(C)(S[CH]2(C(C(=O)N(C(C(=O)[O-])1)2)NC(=O)CCCC([N+])C(=O)[O-]))" cannot be used as a page name in this wiki.