Difference between revisions of "Tiso gene 17030"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLN GLN] == * smiles: ** C(=O)(N)CCC([N+])C([O-])=O * inchi key: ** InChIKey=ZDXPYRJPNDTMRX-VKH...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY3DJ-12 PWY3DJ-12] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY3DJ-12 PWY3DJ-12] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** ceramide de novo biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''4''' reactions found over '''4''' reactions in the full pathway |
− | * | + | * [[3-DEHYDROSPHINGANINE-REDUCTASE-RXN]] |
− | * [[ | + | ** 1 associated gene(s): |
− | * | + | *** [[Tiso_gene_18518]] |
− | * [[ | + | ** 2 reconstruction source(s) associated: |
− | * [[ | + | *** [[annotation-in-silico_annotation]] |
− | * [[ | + | *** [[orthology-creinhardtii]] |
− | * | + | * [[RXN-16332]] |
− | * | + | ** 0 associated gene: |
− | * [[ | + | ** 1 reconstruction source(s) associated: |
− | * [[ | + | *** [[annotation-in-silico_annotation]] |
− | * | + | * [[RXN3DJ-118]] |
− | * [[ | + | ** 0 associated gene: |
− | * [[ | + | ** 1 reconstruction source(s) associated: |
− | * | + | *** [[annotation-in-silico_annotation]] |
− | + | * [[SERINE-C-PALMITOYLTRANSFERASE-RXN]] | |
− | * [[ | + | ** 1 associated gene(s): |
− | * | + | *** [[Tiso_gene_10992]] |
− | + | ** 3 reconstruction source(s) associated: | |
− | * [[ | + | *** [[orthology-athaliana]] |
− | * [[ | + | *** [[annotation-in-silico_annotation]] |
− | + | *** [[orthology-esiliculosus]] | |
− | * [[ | + | == Reaction(s) not found == |
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: common name=ceramide de novo biosynthesis}} | |
− | + | {{#set: reaction found=4}} | |
− | + | {{#set: total reaction=4}} | |
− | + | {{#set: completion rate=100.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 19:30, 18 March 2018
Pathway PWY3DJ-12
- taxonomic range:
- common name:
- ceramide de novo biosynthesis
- Synonym(s):
Reaction(s) found
4 reactions found over 4 reactions in the full pathway
- 3-DEHYDROSPHINGANINE-REDUCTASE-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-16332
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN3DJ-118
- 0 associated gene:
- 1 reconstruction source(s) associated:
- SERINE-C-PALMITOYLTRANSFERASE-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated: