Difference between revisions of "ISOPENICILLIN-N"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Lichenin Lichenin] == * common name: ** lichenan * Synonym(s): ** lichenin ** moss starch == R...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] == * smiles: ** CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C * inchi key: ** InChIK...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] == |
+ | * smiles: | ||
+ | ** CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C | ||
+ | * inchi key: | ||
+ | ** InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** lotaustralin |
+ | * molecular weight: | ||
+ | ** 261.274 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-9674]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-13603]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=441467 441467] |
− | {{#set: consumed by= | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6542 6542] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C08334 C08334] | ||
+ | * HMDB : HMDB33865 | ||
+ | {{#set: smiles=CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C}} | ||
+ | {{#set: inchi key=InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N}} | ||
+ | {{#set: common name=lotaustralin}} | ||
+ | {{#set: molecular weight=261.274 }} | ||
+ | {{#set: common name=2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside}} | ||
+ | {{#set: consumed by=RXN-9674}} | ||
+ | {{#set: produced by=RXN-13603}} |
Revision as of 18:30, 18 March 2018
Contents
Metabolite CPD-10277
- smiles:
- CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C
- inchi key:
- InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N
- common name:
- lotaustralin
- molecular weight:
- 261.274
- Synonym(s):
- 2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links