Difference between revisions of "ISOPENICILLIN-N"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Lichenin Lichenin] == * common name: ** lichenan * Synonym(s): ** lichenin ** moss starch == R...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] == * smiles: ** CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C * inchi key: ** InChIK...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Lichenin Lichenin] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] ==
 +
* smiles:
 +
** CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C
 +
* inchi key:
 +
** InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N
 
* common name:
 
* common name:
** lichenan
+
** lotaustralin
 +
* molecular weight:
 +
** 261.274   
 
* Synonym(s):
 
* Synonym(s):
** lichenin
+
** 2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside
** moss starch
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.2.1.73-RXN]]
+
* [[RXN-9674]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13603]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=lichenan}}
+
* PUBCHEM:
{{#set: common name=lichenin|moss starch}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=441467 441467]
{{#set: consumed by=3.2.1.73-RXN}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6542 6542]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C08334 C08334]
 +
* HMDB : HMDB33865
 +
{{#set: smiles=CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C}}
 +
{{#set: inchi key=InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N}}
 +
{{#set: common name=lotaustralin}}
 +
{{#set: molecular weight=261.274    }}
 +
{{#set: common name=2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside}}
 +
{{#set: consumed by=RXN-9674}}
 +
{{#set: produced by=RXN-13603}}

Revision as of 18:30, 18 March 2018

Metabolite CPD-10277

  • smiles:
    • CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C
  • inchi key:
    • InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N
  • common name:
    • lotaustralin
  • molecular weight:
    • 261.274
  • Synonym(s):
    • 2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links