Difference between revisions of "PWY-7546"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Proteins-L-Threonines Proteins-L-Threonines] == * common name: ** a [protein]-L-threonine * Syn...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] == * smiles: ** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1) * inchi key: ** InChIKey...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Proteins-L-Threonines Proteins-L-Threonines] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] ==
 +
* smiles:
 +
** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1)
 +
* inchi key:
 +
** InChIKey=NKBSFRFTBUHMJF-UHFFFAOYSA-M
 
* common name:
 
* common name:
** a [protein]-L-threonine
+
** cyclic-2,3-O-oxalyl-L-threonate
 +
* molecular weight:
 +
** 189.101   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2,3-cyclic oxalyl theronolactone
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12872]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12869]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-14906]]
 
 
== External links  ==
 
== External links  ==
{{#set: common name=a [protein]-L-threonine}}
+
* PUBCHEM:
{{#set: consumed or produced by=RXN-14906}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659383 90659383]
 +
{{#set: smiles=C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1)}}
 +
{{#set: inchi key=InChIKey=NKBSFRFTBUHMJF-UHFFFAOYSA-M}}
 +
{{#set: common name=cyclic-2,3-O-oxalyl-L-threonate}}
 +
{{#set: molecular weight=189.101    }}
 +
{{#set: common name=2,3-cyclic oxalyl theronolactone}}
 +
{{#set: consumed by=RXN-12872}}
 +
{{#set: produced by=RXN-12869}}

Revision as of 18:30, 18 March 2018

Metabolite CPD-13914

  • smiles:
    • C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1)
  • inchi key:
    • InChIKey=NKBSFRFTBUHMJF-UHFFFAOYSA-M
  • common name:
    • cyclic-2,3-O-oxalyl-L-threonate
  • molecular weight:
    • 189.101
  • Synonym(s):
    • 2,3-cyclic oxalyl theronolactone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1)" cannot be used as a page name in this wiki.