Difference between revisions of "HECT-Ubiquitin-carrier-protein-E3-L-cys"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_8798 == * left end position: ** 4068 * transcription direction: ** NEGATIVE * right end position: ** 7301 * centisome position: ** 41.22416...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-341 CPD0-341] == * smiles: ** C(N)(=O)CCCCC(SC(=O)CCC(=O)[O-])CCS * inchi key: ** InChIKey...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_8798 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-341 CPD0-341] ==
−
* left end position:
+
* smiles:
−
** 4068
+
** C(N)(=O)CCCCC(SC(=O)CCC(=O)[O-])CCS
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=RJCJWONCSKSHES-VIFPVBQESA-M
−
* right end position:
+
* common name:
−
** 7301
+
** S-succinyl-dihydrolipoamide
−
* centisome position:
+
* molecular weight:
−
** 41.22416    
+
** 306.414    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[HISTIDINE--TRNA-LIGASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
== Reaction(s) of unknown directionality ==
−
***ec-number
+
* [[AKGDHe2r]]
−
** experimental_annotation
+
−
***ec-number
+
−
== Pathways associated ==
+
−
* [[TRNA-CHARGING-PWY]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=4068}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657579 90657579]
−
{{#set: right end position=7301}}
+
* CHEBI:
−
{{#set: centisome position=41.22416   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17432 17432]
−
{{#set: reaction associated=HISTIDINE--TRNA-LIGASE-RXN}}
+
* LIGAND-CPD:
−
{{#set: pathway associated=TRNA-CHARGING-PWY}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01169 C01169]
 +
* HMDB : HMDB01177
 +
{{#set: smiles=C(N)(=O)CCCCC(SC(=O)CCC(=O)[O-])CCS}}
 +
{{#set: inchi key=InChIKey=RJCJWONCSKSHES-VIFPVBQESA-M}}
 +
{{#set: common name=S-succinyl-dihydrolipoamide}}
 +
{{#set: molecular weight=306.414   }}
 +
{{#set: reversible reaction associated=AKGDHe2r}}

Revision as of 19:31, 18 March 2018

Metabolite CPD0-341

  • smiles:
    • C(N)(=O)CCCCC(SC(=O)CCC(=O)[O-])CCS
  • inchi key:
    • InChIKey=RJCJWONCSKSHES-VIFPVBQESA-M
  • common name:
    • S-succinyl-dihydrolipoamide
  • molecular weight:
    • 306.414
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(N)(=O)CCCCC(SC(=O)CCC(=O)[O-])CCS" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=HECT-Ubiquitin-carrier-protein-E3-L-cys&oldid=24962"