Difference between revisions of "ATDTD"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] == * smiles: ** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O) * inchi key: ** InChIKe...")
(Created page with "Category:Gene == Gene Tiso_gene_1191 == * left end position: ** 23362 * transcription direction: ** POSITIVE * right end position: ** 24638 * centisome position: ** 92.146...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] ==
+
== Gene Tiso_gene_1191 ==
−
* smiles:
+
* left end position:
−
** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)
+
** 23362
−
* inchi key:
+
* transcription direction:
−
** InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate
+
** 24638
−
* molecular weight:
+
* centisome position:
−
** 185.136    
+
** 92.14689    
 
* Synonym(s):
 
* Synonym(s):
−
** (4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14014]]
+
* [[RXN0-2584]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
* [[DIHYDRODIPICSYN-RXN]]
+
***automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=23362}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678847 70678847]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=24638}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67139 67139]
+
{{#set: centisome position=92.14689   }}
−
{{#set: smiles=C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)}}
+
{{#set: reaction associated=RXN0-2584}}
−
{{#set: inchi key=InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L}}
+
−
{{#set: common name=(2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate}}
+
−
{{#set: molecular weight=185.136   }}
+
−
{{#set: common name=(4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate}}
+
−
{{#set: consumed by=RXN-14014}}
+
−
{{#set: produced by=DIHYDRODIPICSYN-RXN}}
+

Revision as of 18:31, 18 March 2018

Gene Tiso_gene_1191

  • left end position:
    • 23362
  • transcription direction:
    • POSITIVE
  • right end position:
    • 24638
  • centisome position:
    • 92.14689
  • Synonym(s):

Reactions associated

  • RXN0-2584
    • in-silico_annotation
      • automated-name-match

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ATDTD&oldid=25000"