Difference between revisions of "Tiso gene 9236"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] == * smiles: ** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1) * inchi key: ** InChIKey...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-Red-Disulfides Protein-Red-Disulfides] == * common name: ** a protein with reduced sulf...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-Red-Disulfides Protein-Red-Disulfides] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a protein with reduced sulfide groups |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a protein with reduced SH groups |
| + | ** protein with reduced SH groups | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[DISULFOXRED-RXN]] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a protein with reduced sulfide groups}} | |
| − | + | {{#set: common name=a protein with reduced SH groups|protein with reduced SH groups}} | |
| − | + | {{#set: reversible reaction associated=DISULFOXRED-RXN}} | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 18:31, 18 March 2018
Contents
Metabolite Protein-Red-Disulfides
- common name:
- a protein with reduced sulfide groups
- Synonym(s):
- a protein with reduced SH groups
- protein with reduced SH groups
