Difference between revisions of "RXN-11484"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE-1P GALACTOSE-1P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi ke...") |
(Created page with "Category:Gene == Gene Tiso_gene_18959 == * left end position: ** 11 * transcription direction: ** POSITIVE * right end position: ** 2262 * centisome position: ** 0.4089219...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_18959 == |
− | * | + | * left end position: |
− | ** | + | ** 11 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2262 |
− | * | + | * centisome position: |
− | ** | + | ** 0.40892196 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[RXN-11839]] | |
− | + | ** in-silico_annotation | |
− | * [[ | + | ***automated-name-match |
− | * [[ | + | * [[RXN-11840]] |
− | * [[ | + | ** in-silico_annotation |
+ | ***automated-name-match | ||
+ | * [[RXN-11841]] | ||
+ | ** in-silico_annotation | ||
+ | ***automated-name-match | ||
+ | * [[RXN-11842]] | ||
+ | ** in-silico_annotation | ||
+ | ***automated-name-match | ||
+ | * [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=11}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2262}} | |
− | + | {{#set: centisome position=0.40892196 }} | |
− | + | {{#set: reaction associated=RXN-11839|RXN-11840|RXN-11841|RXN-11842|TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 18:31, 18 March 2018
Gene Tiso_gene_18959
- left end position:
- 11
- transcription direction:
- POSITIVE
- right end position:
- 2262
- centisome position:
- 0.40892196
- Synonym(s):
Reactions associated
- RXN-11839
- in-silico_annotation
- automated-name-match
- in-silico_annotation
- RXN-11840
- in-silico_annotation
- automated-name-match
- in-silico_annotation
- RXN-11841
- in-silico_annotation
- automated-name-match
- in-silico_annotation
- RXN-11842
- in-silico_annotation
- automated-name-match
- in-silico_annotation
- TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation