Difference between revisions of "RXN-37"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-341 CPD0-341] == * smiles: ** C(N)(=O)CCCCC(SC(=O)CCC(=O)[O-])CCS * inchi key: ** InChIKey...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7746 PWY-7746] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1762 TAX-17...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7746 PWY-7746] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1762 TAX-1762] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** mycobacterial sulfolipid biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''2''' reactions found over '''8''' reactions in the full pathway | |
| − | == Reaction(s) | + | * [[RXN-9549]] |
| − | * [[ | + | ** 0 associated gene: |
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
| + | * [[RXN3O-9780]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15426 RXN-15426] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17317 RXN-17317] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17318 RXN-17318] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17319 RXN-17319] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17320 RXN-17320] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17323 RXN-17323] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-1762}} | |
| − | + | {{#set: common name=mycobacterial sulfolipid biosynthesis}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=8}} | |
| − | + | {{#set: completion rate=25.0}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 18:31, 18 March 2018
Pathway PWY-7746
- taxonomic range:
- common name:
- mycobacterial sulfolipid biosynthesis
- Synonym(s):
Reaction(s) found
2 reactions found over 8 reactions in the full pathway
- RXN-9549
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN3O-9780
- 0 associated gene:
- 1 reconstruction source(s) associated:
