Difference between revisions of "GDR nadp m"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] == * smiles: ** C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O * inchi key: ** In...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACYL-COA ACYL-COA] == * common name: ** an acyl-CoA * Synonym(s): ** fatty acyl thioester-CoA *...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACYL-COA ACYL-COA] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an acyl-CoA |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** fatty acyl thioester-CoA | ||
| + | ** an acyl-CoA | ||
| + | ** RCH2CH2CO-CoA | ||
| + | ** acyl-Coenzyme A | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[ACYL-COA-OXIDASE-RXN]] |
| + | * [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]] | ||
| + | * [[ACYL-COA-HYDROLASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[2.3.1.23-RXN]] | ||
| + | * [[RXN-13112]] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=an acyl-CoA}} | |
| − | + | {{#set: common name=fatty acyl thioester-CoA|an acyl-CoA|RCH2CH2CO-CoA|acyl-Coenzyme A}} | |
| − | + | {{#set: consumed by=ACYL-COA-OXIDASE-RXN|DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN|ACYL-COA-HYDROLASE-RXN}} | |
| − | + | {{#set: reversible reaction associated=2.3.1.23-RXN|RXN-13112}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 18:31, 18 March 2018
Contents
Metabolite ACYL-COA
- common name:
- an acyl-CoA
- Synonym(s):
- fatty acyl thioester-CoA
- an acyl-CoA
- RCH2CH2CO-CoA
- acyl-Coenzyme A
