Difference between revisions of "ENOYL-ACP-REDUCT-NADH-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10267 CPD-10267] == * smiles: ** CCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(O...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Carboxybiotin-BCCP Carboxybiotin-BCCP] == * common name: ** a carboxylated-biotinylated [BCCP d...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10267 CPD-10267] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Carboxybiotin-BCCP Carboxybiotin-BCCP] ==
−
* smiles:
+
−
** CCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
−
* inchi key:
+
−
** InChIKey=CNKJPHSEFDPYDB-HSJNEKGZSA-J
+
 
* common name:
 
* common name:
−
** decanoyl-CoA
+
** a carboxylated-biotinylated [BCCP dimer]
−
* molecular weight:
+
−
** 917.754   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a carboxylated-biotinylated [biotin carboxyl carrier protein dimer]
 +
** a carboxy-biotin-[BCCP]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-13615]]
+
* [[RXN0-5055]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-13614]]
+
* [[BIOTIN-CARBOXYL-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[RXN-14274]]
 
 
== External links  ==
 
== External links  ==
−
* BIGG : dcacoa
+
{{#set: common name=a carboxylated-biotinylated [BCCP dimer]}}
−
* PUBCHEM:
+
{{#set: common name=a carboxylated-biotinylated [biotin carboxyl carrier protein dimer]|a carboxy-biotin-[BCCP]}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244140 25244140]
+
{{#set: consumed by=RXN0-5055}}
−
* HMDB : HMDB06404
+
{{#set: produced by=BIOTIN-CARBOXYL-RXN}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C05274 C05274]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61430 61430]
+
−
* METABOLIGHTS : MTBLC61430
+
−
{{#set: smiles=CCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=CNKJPHSEFDPYDB-HSJNEKGZSA-J}}
+
−
{{#set: common name=decanoyl-CoA}}
+
−
{{#set: molecular weight=917.754    }}
+
−
{{#set: consumed by=RXN-13615}}
+
−
{{#set: produced by=RXN-13614}}
+
−
{{#set: consumed or produced by=RXN-14274}}
+

Revision as of 18:32, 18 March 2018

Metabolite Carboxybiotin-BCCP

  • common name:
    • a carboxylated-biotinylated [BCCP dimer]
  • Synonym(s):
    • a carboxylated-biotinylated [biotin carboxyl carrier protein dimer]
    • a carboxy-biotin-[BCCP]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a carboxylated-biotinylated [BCCP dimer" cannot be used as a page name in this wiki.
  • "a carboxylated-biotinylated [biotin carboxyl carrier protein dimer" cannot be used as a page name in this wiki.
  • "a carboxy-biotin-[BCCP" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ENOYL-ACP-REDUCT-NADH-RXN&oldid=25085"