Difference between revisions of "CPD-14675"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] == * smiles: ** C(C(=O)C([O-])=O)C(C([O-])=O)O * inchi key: ** InChIKey=WX...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=trans-D2-cis-D19-C38-ACPs trans-D2-cis-D19-C38-ACPs] == * common name: ** a trans-delta2-cis-de...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=trans-D2-cis-D19-C38-ACPs trans-D2-cis-D19-C38-ACPs] ==
* smiles:
+
** C(C(=O)C([O-])=O)C(C([O-])=O)O
+
* inchi key:
+
** InChIKey=WXSKVKPSMAHCSG-REOHCLBHSA-L
+
 
* common name:
 
* common name:
** (4S)-4-hydroxy-2-oxoglutarate
+
** a trans-delta2-cis-delta19-C38:2-[acp]
* molecular weight:
+
** 160.083   
+
 
* Synonym(s):
 
* Synonym(s):
** L-4-hydroxy-2-oxoglutarate
 
** L-4-hydroxy-2-ketoglutarate
 
** (S)-2-hydroxy-4-oxopentanedioate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN1G-1130]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN1G-1084]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-13990]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a trans-delta2-cis-delta19-C38:2-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70698337 70698337]
+
{{#set: consumed by=RXN1G-1130}}
* CHEBI:
+
{{#set: produced by=RXN1G-1084}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71685 71685]
+
* METABOLIGHTS : MTBLC71685
+
{{#set: smiles=C(C(=O)C([O-])=O)C(C([O-])=O)O}}
+
{{#set: inchi key=InChIKey=WXSKVKPSMAHCSG-REOHCLBHSA-L}}
+
{{#set: common name=(4S)-4-hydroxy-2-oxoglutarate}}
+
{{#set: molecular weight=160.083    }}
+
{{#set: common name=L-4-hydroxy-2-oxoglutarate|L-4-hydroxy-2-ketoglutarate|(S)-2-hydroxy-4-oxopentanedioate}}
+
{{#set: consumed or produced by=RXN-13990}}
+

Revision as of 18:32, 18 March 2018

Metabolite trans-D2-cis-D19-C38-ACPs

  • common name:
    • a trans-delta2-cis-delta19-C38:2-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a trans-delta2-cis-delta19-C38:2-[acp" cannot be used as a page name in this wiki.