Difference between revisions of "3.4.11.21-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14998 == * left end position: ** 4276 * transcription direction: ** POSITIVE * right end position: ** 5195 * centisome position: ** 80.7097...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2108 CPD0-2108] == * smiles: ** CCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-]...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2108 CPD0-2108] == |
− | * | + | * smiles: |
− | ** | + | ** CCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=CPSDNAXXKWVYIY-NTLMCJQISA-J |
− | * | + | * common name: |
− | ** | + | ** trans-oct-2-enoyl-CoA |
− | * | + | * molecular weight: |
− | ** | + | ** 887.685 |
* Synonym(s): | * Synonym(s): | ||
+ | ** (2E)-octenoyl-CoA | ||
+ | ** trans-2-octenoyl-coenzyme A | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-14276]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-12669]] | |
− | * [[ | + | * [[ACOA80or]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-14229]] | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05276 C05276] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62242 62242] |
− | {{#set: | + | * BIGG : oc2coa |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173358 46173358] | ||
+ | * HMDB : HMDB03949 | ||
+ | {{#set: smiles=CCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O}} | ||
+ | {{#set: inchi key=InChIKey=CPSDNAXXKWVYIY-NTLMCJQISA-J}} | ||
+ | {{#set: common name=trans-oct-2-enoyl-CoA}} | ||
+ | {{#set: molecular weight=887.685 }} | ||
+ | {{#set: common name=(2E)-octenoyl-CoA|trans-2-octenoyl-coenzyme A}} | ||
+ | {{#set: consumed by=RXN-14276}} | ||
+ | {{#set: produced by=RXN-12669|ACOA80or}} | ||
+ | {{#set: reversible reaction associated=RXN-14229}} |
Revision as of 18:32, 18 March 2018
Contents
Metabolite CPD0-2108
- smiles:
- CCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O
- inchi key:
- InChIKey=CPSDNAXXKWVYIY-NTLMCJQISA-J
- common name:
- trans-oct-2-enoyl-CoA
- molecular weight:
- 887.685
- Synonym(s):
- (2E)-octenoyl-CoA
- trans-2-octenoyl-coenzyme A
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O" cannot be used as a page name in this wiki.