Difference between revisions of "Tiso gene 92"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2108 CPD0-2108] == * smiles: ** CCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-]...")
(Created page with "Category:Gene == Gene Tiso_gene_12104 == * left end position: ** 22 * transcription direction: ** NEGATIVE * right end position: ** 3222 * centisome position: ** 0.3015764...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2108 CPD0-2108] ==
+
== Gene Tiso_gene_12104 ==
−
* smiles:
+
* left end position:
−
** CCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O
+
** 22
−
* inchi key:
+
* transcription direction:
−
** InChIKey=CPSDNAXXKWVYIY-NTLMCJQISA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** trans-oct-2-enoyl-CoA
+
** 3222
−
* molecular weight:
+
* centisome position:
−
** 887.685    
+
** 0.30157644    
 
* Synonym(s):
 
* Synonym(s):
−
** (2E)-octenoyl-CoA
 
−
** trans-2-octenoyl-coenzyme A
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14276]]
+
* [[PHOSGLYPHOS-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** experimental_annotation
−
* [[RXN-12669]]
+
***ec-number
−
* [[ACOA80or]]
+
== Pathways associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[PWY-1042]]
−
* [[RXN-14229]]
+
* [[PWY-7003]]
 +
* [[SUCSYN-PWY]]
 +
* [[GLYCOLYSIS]]
 +
* [[PWY-6901]]
 +
* [[P124-PWY]]
 +
* [[PWY-6886]]
 +
* [[CALVIN-PWY]]
 +
* [[ANAGLYCOLYSIS-PWY]]
 +
* [[GLUCONEO-PWY]]
 +
* [[P122-PWY]]
 +
* [[P185-PWY]]
 +
* [[PWY-5484]]
 +
* [[PWY66-399]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: left end position=22}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05276 C05276]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=3222}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62242 62242]
+
{{#set: centisome position=0.30157644   }}
−
* BIGG : oc2coa
+
{{#set: reaction associated=PHOSGLYPHOS-RXN}}
−
* PUBCHEM:
+
{{#set: pathway associated=PWY-1042|PWY-7003|SUCSYN-PWY|GLYCOLYSIS|PWY-6901|P124-PWY|PWY-6886|CALVIN-PWY|ANAGLYCOLYSIS-PWY|GLUCONEO-PWY|P122-PWY|P185-PWY|PWY-5484|PWY66-399}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173358 46173358]
+
−
* HMDB : HMDB03949
+
−
{{#set: smiles=CCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O}}
+
−
{{#set: inchi key=InChIKey=CPSDNAXXKWVYIY-NTLMCJQISA-J}}
+
−
{{#set: common name=trans-oct-2-enoyl-CoA}}
+
−
{{#set: molecular weight=887.685   }}
+
−
{{#set: common name=(2E)-octenoyl-CoA|trans-2-octenoyl-coenzyme A}}
+
−
{{#set: consumed by=RXN-14276}}
+
−
{{#set: produced by=RXN-12669|ACOA80or}}
+
−
{{#set: consumed or produced by=RXN-14229}}
+

Revision as of 18:33, 18 March 2018

Gene Tiso_gene_12104

  • left end position:
    • 22
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3222
  • centisome position:
    • 0.30157644
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_92&oldid=25229"