Difference between revisions of "CDP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15211 RXN-15211] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-METHYL-MYO-INOSITOL 4-METHYL-MYO-INOSITOL] == * smiles: ** COC1(C(O)C(O)C(O)C(O)C(O)1) * inch...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15211 RXN-15211] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-METHYL-MYO-INOSITOL 4-METHYL-MYO-INOSITOL] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** COC1(C(O)C(O)C(O)C(O)C(O)1)
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.7.8.27 EC-2.7.8.27]
+
** InChIKey=DSCFFEYYQKSRSV-GESKJZQWSA-N
 +
* common name:
 +
** D-ononitol
 +
* molecular weight:
 +
** 194.184   
 
* Synonym(s):
 
* Synonym(s):
 +
** 4-O-methyl-myo-inositol
 +
** ononitol
 +
** 1D-4-O-methyl-myo-inositol
 +
** 4-methyl-myo-inositol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-8281]]
−
** 1 [[PHOSPHATIDYLCHOLINE]][c] '''+''' 1 [[N-Acylsphingosine]][c] '''=>''' 1 [[DIACYLGLYCEROL]][c] '''+''' 1 [[N-acyl-sphingosylphosphorylcholine]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a phosphatidylcholine[c] '''+''' 1 a sphingosine ceramide[c] '''=>''' 1 a 1,2-diacyl-sn-glycerol[c] '''+''' 1 an N-acyl-sphingosylphosphorylcholine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-7277]], sphingolipid biosynthesis (mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7277 PWY-7277]
+
−
** '''5''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY3DJ-11281]], sphingomyelin metabolism: [http://metacyc.org/META/NEW-IMAGE?object=PWY3DJ-11281 PWY3DJ-11281]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
−
{{#set: ec number=EC-2.7.8.27}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C06352 C06352]
−
{{#set: in pathway=PWY-7277|PWY3DJ-11281}}
+
* CHEBI:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18266 18266]
−
{{#set: reconstruction tool=pathwaytools}}
+
* PUBCHEM:
−
{{#set: reconstruction source=in-silico_annotation}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12300199 12300199]
 +
* HMDB : HMDB29915
 +
{{#set: smiles=COC1(C(O)C(O)C(O)C(O)C(O)1)}}
 +
{{#set: inchi key=InChIKey=DSCFFEYYQKSRSV-GESKJZQWSA-N}}
 +
{{#set: common name=D-ononitol}}
 +
{{#set: molecular weight=194.184    }}
 +
{{#set: common name=4-O-methyl-myo-inositol|ononitol|1D-4-O-methyl-myo-inositol|4-methyl-myo-inositol}}
 +
{{#set: consumed by=RXN-8281}}

Revision as of 18:33, 18 March 2018

Metabolite 4-METHYL-MYO-INOSITOL

  • smiles:
    • COC1(C(O)C(O)C(O)C(O)C(O)1)
  • inchi key:
    • InChIKey=DSCFFEYYQKSRSV-GESKJZQWSA-N
  • common name:
    • D-ononitol
  • molecular weight:
    • 194.184
  • Synonym(s):
    • 4-O-methyl-myo-inositol
    • ononitol
    • 1D-4-O-methyl-myo-inositol
    • 4-methyl-myo-inositol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CDP&oldid=25250"