Difference between revisions of "CDP"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15211 RXN-15211] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-METHYL-MYO-INOSITOL 4-METHYL-MYO-INOSITOL] == * smiles: ** COC1(C(O)C(O)C(O)C(O)C(O)1) * inch...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-METHYL-MYO-INOSITOL 4-METHYL-MYO-INOSITOL] == |
− | * | + | * smiles: |
− | ** | + | ** COC1(C(O)C(O)C(O)C(O)C(O)1) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=DSCFFEYYQKSRSV-GESKJZQWSA-N |
+ | * common name: | ||
+ | ** D-ononitol | ||
+ | * molecular weight: | ||
+ | ** 194.184 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 4-O-methyl-myo-inositol | ||
+ | ** ononitol | ||
+ | ** 1D-4-O-methyl-myo-inositol | ||
+ | ** 4-methyl-myo-inositol | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-8281]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06352 C06352] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18266 18266] |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12300199 12300199] |
+ | * HMDB : HMDB29915 | ||
+ | {{#set: smiles=COC1(C(O)C(O)C(O)C(O)C(O)1)}} | ||
+ | {{#set: inchi key=InChIKey=DSCFFEYYQKSRSV-GESKJZQWSA-N}} | ||
+ | {{#set: common name=D-ononitol}} | ||
+ | {{#set: molecular weight=194.184 }} | ||
+ | {{#set: common name=4-O-methyl-myo-inositol|ononitol|1D-4-O-methyl-myo-inositol|4-methyl-myo-inositol}} | ||
+ | {{#set: consumed by=RXN-8281}} |
Revision as of 18:33, 18 March 2018
Contents
Metabolite 4-METHYL-MYO-INOSITOL
- smiles:
- COC1(C(O)C(O)C(O)C(O)C(O)1)
- inchi key:
- InChIKey=DSCFFEYYQKSRSV-GESKJZQWSA-N
- common name:
- D-ononitol
- molecular weight:
- 194.184
- Synonym(s):
- 4-O-methyl-myo-inositol
- ononitol
- 1D-4-O-methyl-myo-inositol
- 4-methyl-myo-inositol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links