Difference between revisions of "Tiso gene 16197"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_14586 == * left end position: ** 1402 * transcription direction: ** NEGATIVE * right end position: ** 3322 * centisome position: ** 25.2430...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] == * smiles: ** C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O * inchi k...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_14586 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] ==
−
* left end position:
+
* smiles:
−
** 1402
+
** C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=QBOLVLBSUGJHGB-WDSKDSINSA-M
−
* right end position:
+
* common name:
−
** 3322
+
** S-sulfanylglutathione
−
* centisome position:
+
* molecular weight:
−
** 25.243069    
+
** 338.373    
 
* Synonym(s):
 
* Synonym(s):
 +
** GSSH
 +
** glutathione-sulfide
 +
** glutathione persulfide
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN0-5462]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
* [[RXN-15348]]
−
***automated-name-match
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
* [[RXN-10851]]
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=1402}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878477 46878477]
−
{{#set: right end position=3322}}
+
* CHEBI:
−
{{#set: centisome position=25.243069   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58905 58905]
−
{{#set: reaction associated=RXN0-5462}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C17267 C17267]
 +
{{#set: smiles=C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}}
 +
{{#set: inchi key=InChIKey=QBOLVLBSUGJHGB-WDSKDSINSA-M}}
 +
{{#set: common name=S-sulfanylglutathione}}
 +
{{#set: molecular weight=338.373   }}
 +
{{#set: common name=GSSH|glutathione-sulfide|glutathione persulfide}}
 +
{{#set: produced by=RXN-15348}}
 +
{{#set: reversible reaction associated=RXN-10851}}

Revision as of 18:33, 18 March 2018

Metabolite CPD-11281

  • smiles:
    • C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
  • inchi key:
    • InChIKey=QBOLVLBSUGJHGB-WDSKDSINSA-M
  • common name:
    • S-sulfanylglutathione
  • molecular weight:
    • 338.373
  • Synonym(s):
    • GSSH
    • glutathione-sulfide
    • glutathione persulfide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_16197&oldid=25256"