Difference between revisions of "PANTOTHENATE-KIN-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-787 CPD-787] == * smiles: ** C([O-])(=O)CC=CC=C(O)C(=O)[O-] * inchi key: ** InChIKey=ZBCBET...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.24-RXN 3.2.1.24-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.o...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.24-RXN 3.2.1.24-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.2.1.24 EC-3.2.1.24] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[WATER]][c] '''+''' 1 [[Alpha-D-Mannosides]][c] '''=>''' 1 [[Non-Glycosylated-sugar-Acceptors]][c] '''+''' 1 [[CPD-13559]][c] |
− | == | + | * With common name(s): |
+ | ** 1 H2O[c] '''+''' 1 an α-D-mannoside[c] '''=>''' 1 a non glycosylated sugar acceptor[c] '''+''' 1 α-D-mannopyranose[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_6748]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * UNIPROT: |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P21139 P21139] |
− | * | + | ** [http://www.uniprot.org/uniprot/P34098 P34098] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P39098 P39098] |
− | * | + | ** [http://www.uniprot.org/uniprot/P22855 P22855] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q43249 Q43249] |
− | * | + | ** [http://www.uniprot.org/uniprot/O13344 O13344] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/O46432 O46432] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O09159 O09159] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9NTJ4 Q9NTJ4] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: ec number=EC-3.2.1.24}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_6748}} |
− | {{#set: | + | {{#set: in pathway=}} |
+ | {{#set: reconstruction category=orthology}} | ||
+ | {{#set: reconstruction source=orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph}} |
Revision as of 18:33, 18 March 2018
Contents
Reaction 3.2.1.24-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 Alpha-D-Mannosides[c] => 1 Non-Glycosylated-sugar-Acceptors[c] + 1 CPD-13559[c]
- With common name(s):
- 1 H2O[c] + 1 an α-D-mannoside[c] => 1 a non glycosylated sugar acceptor[c] + 1 α-D-mannopyranose[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links