Difference between revisions of "Tiso gene 14419"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPATE TROPATE] == * smiles: ** C(O)C(C1(C=CC=CC=1))C([O-])=O * inchi key: ** InChIKey=JACRWUW...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-methionyl-L-cysteinyl-Protein L-methionyl-L-cysteinyl-Protein] == * common name: ** an N-term...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-methionyl-L-cysteinyl-Protein L-methionyl-L-cysteinyl-Protein] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an N-terminal-L-methionyl-L-cysteinyl-[protein] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-17874]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=an N-terminal-L-methionyl-L-cysteinyl-[protein]}} | |
| − | + | {{#set: consumed by=RXN-17874}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 19:34, 18 March 2018
Contents
Metabolite L-methionyl-L-cysteinyl-Protein
- common name:
- an N-terminal-L-methionyl-L-cysteinyl-[protein]
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an N-terminal-L-methionyl-L-cysteinyl-[protein" cannot be used as a page name in this wiki.
