Difference between revisions of "RXN-4209"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL-PYRUVATE PHENYL-PYRUVATE] == * smiles: ** C([O-])(=O)C(=O)CC1(=CC=CC=C1) * inchi key: **...") |
(Created page with "Category:Gene == Gene Tiso_gene_19262 == * left end position: ** 77 * transcription direction: ** POSITIVE * right end position: ** 1694 * centisome position: ** 3.1123686...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_19262 == |
− | * | + | * left end position: |
− | ** | + | ** 77 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 1694 |
− | * | + | * centisome position: |
− | ** | + | ** 3.1123686 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[PROTEIN-ARGININE-DEIMINASE-RXN]] |
− | * | + | ** in-silico_annotation |
− | + | ***ec-number | |
− | == | + | == Pathways associated == |
− | * [[ | + | * [[PWY-4921]] |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=77}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=1694}} | |
− | + | {{#set: centisome position=3.1123686 }} | |
− | + | {{#set: reaction associated=PROTEIN-ARGININE-DEIMINASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-4921}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 18:34, 18 March 2018
Gene Tiso_gene_19262
- left end position:
- 77
- transcription direction:
- POSITIVE
- right end position:
- 1694
- centisome position:
- 3.1123686
- Synonym(s):
Reactions associated
- PROTEIN-ARGININE-DEIMINASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation