Difference between revisions of "Tiso gene 6882"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1834 CPD-1834] == * smiles: ** CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Alkylated-DNAs Alkylated-DNAs] == * common name: ** an alkylated DNA * Synonym(s): == Reaction...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1834 CPD-1834] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Alkylated-DNAs Alkylated-DNAs] ==
* smiles:
+
** CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))
+
* inchi key:
+
** InChIKey=ITZYGDKGRKKBSN-RXDNHGQQSA-M
+
 
* common name:
 
* common name:
** (25R)-3α,7α-dihydroxy-5-β-cholestanate
+
** an alkylated DNA
* molecular weight:
+
** 433.65   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-α,7-α-dihydroxy-5-β-cholestanoate
 
** 3-α,7-α-dihydroxy-5-β-cholestanate
 
** (25R)-3α,7α-dihydroxy-5-β-cholestan-26-oate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.2.2.21-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9844]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an alkylated DNA}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266753 45266753]
+
{{#set: consumed by=3.2.2.21-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58750 58750]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C04554 C04554]
+
{{#set: smiles=CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))}}
+
{{#set: inchi key=InChIKey=ITZYGDKGRKKBSN-RXDNHGQQSA-M}}
+
{{#set: common name=(25R)-3α,7α-dihydroxy-5-β-cholestanate}}
+
{{#set: molecular weight=433.65    }}
+
{{#set: common name=3-α,7-α-dihydroxy-5-β-cholestanoate|3-α,7-α-dihydroxy-5-β-cholestanate|(25R)-3α,7α-dihydroxy-5-β-cholestan-26-oate}}
+
{{#set: produced by=RXN-9844}}
+

Revision as of 18:34, 18 March 2018

Metabolite Alkylated-DNAs

  • common name:
    • an alkylated DNA
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links