Difference between revisions of "Tiso gene 6822"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17011 RXN-17011] == * direction: ** LEFT-TO-RIGHT * common name: ** 1-acylglycerol-3-phosphate_...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9956 CPD-9956] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9956 CPD-9956] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1) |
+ | * inchi key: | ||
+ | ** InChIKey=LOJUQFSPYHMHEO-SGHXUWJISA-N | ||
* common name: | * common name: | ||
− | ** | + | ** ubiquinol-8 |
− | * | + | * molecular weight: |
− | ** | + | ** 729.137 |
* Synonym(s): | * Synonym(s): | ||
+ | ** ubiquinol(8) | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[DHHB-METHYLTRANSFER-RXN]] | |
− | + | * [[NADHor_2m]] | |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25074411 25074411] | |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61682 61682] |
− | {{#set: | + | * BIGG : q8h2 |
− | {{#set: | + | * HMDB : HMDB01060 |
− | {{#set: | + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=LOJUQFSPYHMHEO-SGHXUWJISA-N}} |
+ | {{#set: common name=ubiquinol-8}} | ||
+ | {{#set: molecular weight=729.137 }} | ||
+ | {{#set: common name=ubiquinol(8)}} | ||
+ | {{#set: produced by=DHHB-METHYLTRANSFER-RXN|NADHor_2m}} |
Revision as of 18:35, 18 March 2018
Contents
Metabolite CPD-9956
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)
- inchi key:
- InChIKey=LOJUQFSPYHMHEO-SGHXUWJISA-N
- common name:
- ubiquinol-8
- molecular weight:
- 729.137
- Synonym(s):
- ubiquinol(8)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links