Difference between revisions of "1TRANSKETO-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_7843 == * Synonym(s): == Reactions associated == * PROTEIN-KINASE-RXN ** pantograph-esiliculosus == Pathways associated == ==...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-602 CPD-602] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)NC2(=C(N)C(=O)NC(=O)N2)) *...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_7843 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-602 CPD-602] ==
 +
* smiles:
 +
** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)NC2(=C(N)C(=O)NC(=O)N2))
 +
* inchi key:
 +
** InChIKey=LZEXYCAGPMYXLX-UMMCILCDSA-L
 +
* common name:
 +
** 5-amino-6-(5-phospho-D-ribosylamino)uracil
 +
* molecular weight:
 +
** 352.197   
 
* Synonym(s):
 
* Synonym(s):
 +
** 5-amino-6-(ribosylamino)-2,4-(1H,3H)-pyrimidinedione 5'-phosphate
 +
** 5-amino-6-(5'-phosphoribosylamino)uracil
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[PROTEIN-KINASE-RXN]]
+
* [[RIBOFLAVINSYNREDUC-RXN]]
** [[pantograph]]-[[esiliculosus]]
+
== Reaction(s) known to produce the compound ==
== Pathways associated ==
+
* [[RIBOFLAVINSYNDEAM-RXN]]
 +
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245199 25245199]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58453 58453]
 +
* BIGG : 5apru
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C01268 C01268]
 +
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)NC2(=C(N)C(=O)NC(=O)N2))}}
 +
{{#set: inchi key=InChIKey=LZEXYCAGPMYXLX-UMMCILCDSA-L}}
 +
{{#set: common name=5-amino-6-(5-phospho-D-ribosylamino)uracil}}
 +
{{#set: molecular weight=352.197    }}
 +
{{#set: common name=5-amino-6-(ribosylamino)-2,4-(1H,3H)-pyrimidinedione 5'-phosphate|5-amino-6-(5'-phosphoribosylamino)uracil}}
 +
{{#set: consumed by=RIBOFLAVINSYNREDUC-RXN}}
 +
{{#set: produced by=RIBOFLAVINSYNDEAM-RXN}}

Revision as of 18:35, 18 March 2018

Metabolite CPD-602

  • smiles:
    • C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)NC2(=C(N)C(=O)NC(=O)N2))
  • inchi key:
    • InChIKey=LZEXYCAGPMYXLX-UMMCILCDSA-L
  • common name:
    • 5-amino-6-(5-phospho-D-ribosylamino)uracil
  • molecular weight:
    • 352.197
  • Synonym(s):
    • 5-amino-6-(ribosylamino)-2,4-(1H,3H)-pyrimidinedione 5'-phosphate
    • 5-amino-6-(5'-phosphoribosylamino)uracil

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)NC2(=C(N)C(=O)NC(=O)N2))" cannot be used as a page name in this wiki.