Difference between revisions of "2.1.1.113-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-420 CPD-420] == * smiles: ** CC(NC(C(=O)[O-])CC(=O)[O-])=O * inchi key: ** InChIKey=OTCCIMW...") |
(Created page with "Category:Gene == Gene Tiso_gene_6679 == * left end position: ** 1527 * transcription direction: ** POSITIVE * right end position: ** 3307 * centisome position: ** 6.608959...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_6679 == |
− | * | + | * left end position: |
− | ** | + | ** 1527 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3307 |
− | * | + | * centisome position: |
− | ** | + | ** 6.608959 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[GLUTATHIONE-PEROXIDASE-RXN]] | |
− | == | + | ** in-silico_annotation |
− | * [[ | + | ***ec-number |
+ | == Pathways associated == | ||
+ | * [[DETOX1-PWY-1]] | ||
+ | * [[PWY-4081]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1527}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3307}} | |
− | + | {{#set: centisome position=6.608959 }} | |
− | + | {{#set: reaction associated=GLUTATHIONE-PEROXIDASE-RXN}} | |
− | + | {{#set: pathway associated=DETOX1-PWY-1|PWY-4081}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:36, 18 March 2018
Gene Tiso_gene_6679
- left end position:
- 1527
- transcription direction:
- POSITIVE
- right end position:
- 3307
- centisome position:
- 6.608959
- Synonym(s):
Reactions associated
- GLUTATHIONE-PEROXIDASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation