Difference between revisions of "L-methionyl-L-seryl-Protein"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16825 CPD-16825] == * smiles: ** C1(C=C(C=C2(OCC(CC=12)C3(C=CC(=CC=3)OS([O-])(=O)=O)))O) *...")
(Created page with "Category:Gene == Gene Tiso_gene_9051 == * left end position: ** 913 * transcription direction: ** POSITIVE * right end position: ** 3946 * centisome position: ** 9.449390...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16825 CPD-16825] ==
+
== Gene Tiso_gene_9051 ==
−
* smiles:
+
* left end position:
−
** C1(C=C(C=C2(OCC(CC=12)C3(C=CC(=CC=3)OS([O-])(=O)=O)))O)
+
** 913
−
* inchi key:
+
* transcription direction:
−
** InChIKey=UXOJWGSGKUYMIA-GFCCVEGCSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (S)-equol 4'-sulfate
+
** 3946
−
* molecular weight:
+
* centisome position:
−
** 321.324    
+
** 9.449390    
 
* Synonym(s):
 
* Synonym(s):
−
** 4',7-isoflavandiol 4'-sulfate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** in-silico_annotation
−
* [[RXN-15589]]
+
***ec-number
 +
** [[pantograph]]-[[esiliculosus]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways associated ==
 +
* [[UDPNACETYLGALSYN-PWY]]
 +
* [[PWY-6749]]
 +
* [[UDPNAGSYN-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=913}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=29979373 29979373]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C1(C=C(C=C2(OCC(CC=12)C3(C=CC(=CC=3)OS([O-])(=O)=O)))O)}}
+
{{#set: right end position=3946}}
−
{{#set: inchi key=InChIKey=UXOJWGSGKUYMIA-GFCCVEGCSA-M}}
+
{{#set: centisome position=9.449390   }}
−
{{#set: common name=(S)-equol 4'-sulfate}}
+
{{#set: reaction associated=L-GLN-FRUCT-6-P-AMINOTRANS-RXN}}
−
{{#set: molecular weight=321.324   }}
+
{{#set: pathway associated=UDPNACETYLGALSYN-PWY|PWY-6749|UDPNAGSYN-PWY}}
−
{{#set: common name=4',7-isoflavandiol 4'-sulfate}}
+
−
{{#set: consumed or produced by=RXN-15589}}
+

Revision as of 18:36, 18 March 2018

Gene Tiso_gene_9051

  • left end position:
    • 913
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3946
  • centisome position:
    • 9.449390
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=L-methionyl-L-seryl-Protein&oldid=25606"