Difference between revisions of "DCMP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE PYRIDOXAMINE] == * smiles: ** CC1(=NC=C(CO)C(C[N+])=C(O)1) * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Amino-Acids L-Amino-Acids] == * common name: ** an L-amino acid * Synonym(s): ** an L-Amino a...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Amino-Acids L-Amino-Acids] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an L-amino acid |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** an L-Amino acid |
| + | ** an L-2-amino-acid | ||
| + | ** L-α-amino acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.4.11.2-RXN]] |
| + | * [[GAMMA-GLUTAMYLCYCLOTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=an L-amino acid}} | |
| − | + | {{#set: common name=an L-Amino acid|an L-2-amino-acid|L-α-amino acid}} | |
| − | + | {{#set: produced by=3.4.11.2-RXN|GAMMA-GLUTAMYLCYCLOTRANSFERASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 18:37, 18 March 2018
Contents
Metabolite L-Amino-Acids
- common name:
- an L-amino acid
- Synonym(s):
- an L-Amino acid
- an L-2-amino-acid
- L-α-amino acid
