Difference between revisions of "RXN-14350"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE-1-P N-ACETYL-D-GLUCOSAMINE-1-P] == * smiles: ** CC(=O)NC1(C(O)C(O)C(CO)O...")
(Created page with "Category:Gene == Gene Tiso_gene_8432 == * left end position: ** 20 * transcription direction: ** POSITIVE * right end position: ** 1240 * centisome position: ** 0.1952553...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE-1-P N-ACETYL-D-GLUCOSAMINE-1-P] ==
+
== Gene Tiso_gene_8432 ==
−
* smiles:
+
* left end position:
−
** CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1)
+
** 20
−
* inchi key:
+
* transcription direction:
−
** InChIKey=FZLJPEPAYPUMMR-FMDGEEDCSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** N-acetyl-α-D-glucosamine 1-phosphate
+
** 1240
−
* molecular weight:
+
* centisome position:
−
** 299.174    
+
** 0.1952553    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[NAG1P-URIDYLTRANS-RXN]]
+
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
* [[RXN-16426]]
+
***ec-number
−
== Reaction(s) of unknown directionality ==
+
** experimental_annotation
−
* [[PHOSACETYLGLUCOSAMINEMUT-RXN]]
+
***ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: left end position=20}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04256 C04256]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=1240}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57776 57776]
+
{{#set: centisome position=0.1952553   }}
−
* BIGG : acgam1p
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243937 25243937]
+
−
* HMDB : HMDB01367
+
−
{{#set: smiles=CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1)}}
+
−
{{#set: inchi key=InChIKey=FZLJPEPAYPUMMR-FMDGEEDCSA-L}}
+
−
{{#set: common name=N-acetyl-α-D-glucosamine 1-phosphate}}
+
−
{{#set: molecular weight=299.174   }}
+
−
{{#set: consumed by=NAG1P-URIDYLTRANS-RXN}}
+
−
{{#set: produced by=RXN-16426}}
+
−
{{#set: consumed or produced by=PHOSACETYLGLUCOSAMINEMUT-RXN}}
+

Revision as of 18:37, 18 March 2018

Gene Tiso_gene_8432

  • left end position:
    • 20
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1240
  • centisome position:
    • 0.1952553
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14350&oldid=25718"