Difference between revisions of "GLYCEROPHOSPHOGLYCEROL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8564 CPD-8564] == * smiles: ** C(O)C(C(=O)N[R])NC(=O)[R] * common name: ** myosin light-cha...") |
(Created page with "Category:Gene == Gene Tiso_gene_8773 == * left end position: ** 4156 * transcription direction: ** POSITIVE * right end position: ** 6235 * centisome position: ** 41.97132...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_8773 == |
− | * | + | * left end position: |
− | ** | + | ** 4156 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
+ | * right end position: | ||
+ | ** 6235 | ||
+ | * centisome position: | ||
+ | ** 41.97132 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | + | * [[CYTOCHROME-B5-REDUCTASE-RXN]] | |
− | + | ** in-silico_annotation | |
− | * [[ | + | ***automated-name-match |
+ | * [[RXN-11195]] | ||
+ | ** in-silico_annotation | ||
+ | ***automated-name-match | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4156}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | {{#set: | + | {{#set: right end position=6235}} |
− | {{#set: | + | {{#set: centisome position=41.97132 }} |
− | {{#set: | + | {{#set: reaction associated=CYTOCHROME-B5-REDUCTASE-RXN|RXN-11195}} |
Revision as of 19:37, 18 March 2018
Gene Tiso_gene_8773
- left end position:
- 4156
- transcription direction:
- POSITIVE
- right end position:
- 6235
- centisome position:
- 41.97132
- Synonym(s):
Reactions associated
- CYTOCHROME-B5-REDUCTASE-RXN
- in-silico_annotation
- automated-name-match
- in-silico_annotation
- RXN-11195
- in-silico_annotation
- automated-name-match
- in-silico_annotation