Difference between revisions of "GLYCEROPHOSPHOGLYCEROL"

Revision as of 19:37, 18 March 2018

@@ Line 1: / Line 1: @@
-[[Category:Metabolite]]
+[[Category:Gene]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8564 CPD-8564] ==
+== Gene Tiso_gene_8773 ==
-* smiles:
+* left end position:
-** C(O)C(C(=O)N[R])NC(=O)[R]
+** 4156
-* common name:
+* transcription direction:
-** myosin light-chain
+** POSITIVE
+* right end position:
+** 6235
+* centisome position:
+** 41.97132
 * Synonym(s):
-== Reaction(s) known to consume the compound ==
+== Reactions associated ==
-== Reaction(s) known to produce the compound ==
+* [[CYTOCHROME-B5-REDUCTASE-RXN]]
-== Reaction(s) of unknown directionality ==
+** in-silico_annotation
-* [[2.7.11.18-RXN]]
+***automated-name-match
+* [[RXN-11195]]
+** in-silico_annotation
+***automated-name-match
+== Pathways associated ==
 == External links  ==
-* LIGAND-CPD:
+{{#set: left end position=4156}}
-** [http://www.genome.jp/dbget-bin/www_bget?C01003 C01003]
+{{#set: transcription direction=POSITIVE}}
-{{#set: smiles=C(O)C(C(=O)N[R])NC(=O)[R]}}
+{{#set: right end position=6235}}
-{{#set: common name=myosin light-chain}}
+{{#set: centisome position=41.97132    }}
-{{#set: consumed or produced by=2.7.11.18-RXN}}
+{{#set: reaction associated=CYTOCHROME-B5-REDUCTASE-RXN|RXN-11195}}