Difference between revisions of "Tiso gene 10528"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-PRENYL-L-CYSTEINE S-PRENYL-L-CYSTEINE] == * smiles: ** CC(C)=CCSCC([N+])C(=O)[O-] * inchi key...")
(Created page with "Category:Gene == Gene Tiso_gene_5334 == * left end position: ** 10225 * transcription direction: ** POSITIVE * right end position: ** 10356 * centisome position: ** 51.534...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-PRENYL-L-CYSTEINE S-PRENYL-L-CYSTEINE] ==
+
== Gene Tiso_gene_5334 ==
−
* smiles:
+
* left end position:
−
** CC(C)=CCSCC([N+])C(=O)[O-]
+
** 10225
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ULHWZNASVJIOEM-ZETCQYMHSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** S-prenyl-L-cysteine
+
** 10356
−
* molecular weight:
+
* centisome position:
−
** 189.272    
+
** 51.5347    
 
* Synonym(s):
 
* Synonym(s):
−
** prenyl-L-cysteine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[1.8.3.5-RXN]]
+
* [[GLYCPDIESTER-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
* [[RXN-14073]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-14136]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-14160]]
 +
** in-silico_annotation
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-7409]]
 +
* [[PWY-6952]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=10225}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200435 25200435]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=10356}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47914 47914]
+
{{#set: centisome position=51.5347   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=GLYCPDIESTER-RXN|RXN-14073|RXN-14136|RXN-14160}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06751 C06751]
+
{{#set: pathway associated=PWY-7409|PWY-6952}}
−
* HMDB : HMDB12286
+
−
{{#set: smiles=CC(C)=CCSCC([N+])C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=ULHWZNASVJIOEM-ZETCQYMHSA-N}}
+
−
{{#set: common name=S-prenyl-L-cysteine}}
+
−
{{#set: molecular weight=189.272   }}
+
−
{{#set: common name=prenyl-L-cysteine}}
+
−
{{#set: consumed by=1.8.3.5-RXN}}
+

Revision as of 18:38, 18 March 2018

Gene Tiso_gene_5334

  • left end position:
    • 10225
  • transcription direction:
    • POSITIVE
  • right end position:
    • 10356
  • centisome position:
    • 51.5347
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_10528&oldid=25769"