Difference between revisions of "L-phenylalanyl-L-arginyl-Protein"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_8006 == * left end position: ** 4591 * transcription direction: ** POSITIVE * right end position: ** 6208 * centisome position: ** 43.19315...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12853 CPD-12853] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_8006 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12853 CPD-12853] ==
* left end position:
+
* smiles:
** 4591
+
** CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N
* right end position:
+
* common name:
** 6208
+
** 4α-methyl-5α-cholesta-8,14,24-trien-3β-ol
* centisome position:
+
* molecular weight:
** 43.19315    
+
** 396.655    
 
* Synonym(s):
 
* Synonym(s):
 +
** cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** in-silico_annotation
+
* [[RXN-11881]]
***automated-name-match
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[TRIGLSYN-PWY]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=4591}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102514956 102514956]
{{#set: right end position=6208}}
+
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}}
{{#set: centisome position=43.19315   }}
+
{{#set: inchi key=InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N}}
{{#set: reaction associated=DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN}}
+
{{#set: common name=4α-methyl-5α-cholesta-8,14,24-trien-3β-ol}}
{{#set: pathway associated=TRIGLSYN-PWY}}
+
{{#set: molecular weight=396.655   }}
 +
{{#set: common name=cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-}}
 +
{{#set: produced by=RXN-11881}}

Revision as of 18:38, 18 March 2018

Metabolite CPD-12853

  • smiles:
    • CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
  • inchi key:
    • InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N
  • common name:
    • 4α-methyl-5α-cholesta-8,14,24-trien-3β-ol
  • molecular weight:
    • 396.655
  • Synonym(s):
    • cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.