Difference between revisions of "L-phenylalanyl-L-arginyl-Protein"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_8006 == * left end position: ** 4591 * transcription direction: ** POSITIVE * right end position: ** 6208 * centisome position: ** 43.19315...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12853 CPD-12853] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12853 CPD-12853] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34)))) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N |
− | * | + | * common name: |
− | ** | + | ** 4α-methyl-5α-cholesta-8,14,24-trien-3β-ol |
− | * | + | * molecular weight: |
− | ** | + | ** 396.655 |
* Synonym(s): | * Synonym(s): | ||
+ | ** cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)- | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-11881]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102514956 102514956] |
− | {{#set: | + | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N}} |
− | {{#set: | + | {{#set: common name=4α-methyl-5α-cholesta-8,14,24-trien-3β-ol}} |
− | {{#set: | + | {{#set: molecular weight=396.655 }} |
+ | {{#set: common name=cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-}} | ||
+ | {{#set: produced by=RXN-11881}} |
Revision as of 19:38, 18 March 2018
Contents
Metabolite CPD-12853
- smiles:
- CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
- inchi key:
- InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N
- common name:
- 4α-methyl-5α-cholesta-8,14,24-trien-3β-ol
- molecular weight:
- 396.655
- Synonym(s):
- cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.