Difference between revisions of "CPD-10806"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_9428 == * Synonym(s): == Reactions associated == * RXN-1224 ** pantograph-esiliculosus * RXN-15117 ** pantograph-ath...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17422 CPD-17422] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17422 CPD-17422] == |
+ | * smiles: | ||
+ | ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34)))) | ||
+ | * inchi key: | ||
+ | ** InChIKey=VIPVRXUSPSUXNI-XDMMOTQBSA-N | ||
+ | * common name: | ||
+ | ** 3-dehydro-6-hydroxyteasterone | ||
+ | * molecular weight: | ||
+ | ** 448.685 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-11535]] | |
− | * [[RXN- | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515138 102515138] |
+ | {{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}} | ||
+ | {{#set: inchi key=InChIKey=VIPVRXUSPSUXNI-XDMMOTQBSA-N}} | ||
+ | {{#set: common name=3-dehydro-6-hydroxyteasterone}} | ||
+ | {{#set: molecular weight=448.685 }} | ||
+ | {{#set: produced by=RXN-11535}} |
Revision as of 19:38, 18 March 2018
Contents
Metabolite CPD-17422
- smiles:
- CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=VIPVRXUSPSUXNI-XDMMOTQBSA-N
- common name:
- 3-dehydro-6-hydroxyteasterone
- molecular weight:
- 448.685
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.