Difference between revisions of "UPH"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6705 RXN0-6705] == * direction: ** LEFT-TO-RIGHT * common name: ** 1-acylglycerol-3-phosphate_...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE GALACTOSE] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * inchi key: ** InChIKey=WQZGKK...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE GALACTOSE] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)C1(OC(O)C(O)C(O)C(O)1) |
+ | * inchi key: | ||
+ | ** InChIKey=WQZGKKKJIJFFOK-FPRJBGLDSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** β-D-galactose |
− | * | + | * molecular weight: |
− | ** | + | ** 180.157 |
* Synonym(s): | * Synonym(s): | ||
+ | ** β-D-galactopyranose | ||
+ | ** cerebrose | ||
+ | ** 6-(hydroxymethyl)tetrahydropyran-2,3,4,5-tetraol | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[BETAGALACTOSID-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[ALDOSE1EPIM-RXN]] | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * CAS : 7296-64-2 | |
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439353 439353] | |
− | + | * HMDB : HMDB03449 | |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00962 C00962] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.388476.html 388476] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28034 28034] |
− | {{#set: | + | * BIGG : gal |
+ | * BIGG : gal-bD | ||
+ | {{#set: smiles=C(O)C1(OC(O)C(O)C(O)C(O)1)}} | ||
+ | {{#set: inchi key=InChIKey=WQZGKKKJIJFFOK-FPRJBGLDSA-N}} | ||
+ | {{#set: common name=β-D-galactose}} | ||
+ | {{#set: molecular weight=180.157 }} | ||
+ | {{#set: common name=β-D-galactopyranose|cerebrose|6-(hydroxymethyl)tetrahydropyran-2,3,4,5-tetraol}} | ||
+ | {{#set: produced by=BETAGALACTOSID-RXN}} | ||
+ | {{#set: reversible reaction associated=ALDOSE1EPIM-RXN}} |
Revision as of 18:38, 18 March 2018
Contents
Metabolite GALACTOSE
- smiles:
- C(O)C1(OC(O)C(O)C(O)C(O)1)
- inchi key:
- InChIKey=WQZGKKKJIJFFOK-FPRJBGLDSA-N
- common name:
- β-D-galactose
- molecular weight:
- 180.157
- Synonym(s):
- β-D-galactopyranose
- cerebrose
- 6-(hydroxymethyl)tetrahydropyran-2,3,4,5-tetraol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 7296-64-2
- PUBCHEM:
- HMDB : HMDB03449
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : gal
- BIGG : gal-bD