Difference between revisions of "Tiso gene 13203"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17422 CPD-17422] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)...")
(Created page with "Category:Gene == Gene Tiso_gene_5184 == * left end position: ** 3517 * transcription direction: ** POSITIVE * right end position: ** 5729 * centisome position: ** 25.47074...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17422 CPD-17422] ==
+
== Gene Tiso_gene_5184 ==
* smiles:
+
* left end position:
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** 3517
* inchi key:
+
* transcription direction:
** InChIKey=VIPVRXUSPSUXNI-XDMMOTQBSA-N
+
** POSITIVE
* common name:
+
* right end position:
** 3-dehydro-6-hydroxyteasterone
+
** 5729
* molecular weight:
+
* centisome position:
** 448.685    
+
** 25.470743    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
* [[RXN-11535]]
+
** in-silico_annotation
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=3517}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515138 102515138]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: right end position=5729}}
{{#set: inchi key=InChIKey=VIPVRXUSPSUXNI-XDMMOTQBSA-N}}
+
{{#set: centisome position=25.470743   }}
{{#set: common name=3-dehydro-6-hydroxyteasterone}}
+
{{#set: reaction associated=DNA-DIRECTED-DNA-POLYMERASE-RXN}}
{{#set: molecular weight=448.685   }}
+
{{#set: produced by=RXN-11535}}
+

Revision as of 19:38, 18 March 2018

Gene Tiso_gene_5184

  • left end position:
    • 3517
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5729
  • centisome position:
    • 25.470743
  • Synonym(s):

Reactions associated

Pathways associated

External links