Difference between revisions of "RXN-12669"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_13203 == * left end position: ** 4651 * transcription direction: ** POSITIVE * right end position: ** 5268 * centisome position: ** 72.0303...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1825 CPD-1825] == * smiles: ** C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O) * inchi key: ** InChIKey...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1825 CPD-1825] == |
| − | * | + | * smiles: |
| − | ** | + | ** C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=ILXHFXFPPZGENN-QMKXCQHVSA-L |
| − | * | + | * common name: |
| − | ** | + | ** β-L-arabinose 1-phosphate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 228.095 |
* Synonym(s): | * Synonym(s): | ||
| + | ** β-L-arabinose 1-P | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[UMPU]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244737 25244737] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57521 57521] |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C03906 C03906] | ||
| + | * HMDB : HMDB12195 | ||
| + | {{#set: smiles=C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O)}} | ||
| + | {{#set: inchi key=InChIKey=ILXHFXFPPZGENN-QMKXCQHVSA-L}} | ||
| + | {{#set: common name=β-L-arabinose 1-phosphate}} | ||
| + | {{#set: molecular weight=228.095 }} | ||
| + | {{#set: common name=β-L-arabinose 1-P}} | ||
| + | {{#set: consumed by=UMPU}} | ||
Revision as of 18:38, 18 March 2018
Contents
Metabolite CPD-1825
- smiles:
- C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O)
- inchi key:
- InChIKey=ILXHFXFPPZGENN-QMKXCQHVSA-L
- common name:
- β-L-arabinose 1-phosphate
- molecular weight:
- 228.095
- Synonym(s):
- β-L-arabinose 1-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O)" cannot be used as a page name in this wiki.
