Difference between revisions of "ATDCMf"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D19-31-C50-2-ACPs cis-cis-D19-31-C50-2-ACPs] == * common name: ** a cis,cis-delta19,31-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OH-PYR OH-PYR] == * smiles: ** C(C(=O)C([O-])=O)O * inchi key: ** InChIKey=HHDDCCUIIUWNGJ-UHFFF...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OH-PYR OH-PYR] == |
| + | * smiles: | ||
| + | ** C(C(=O)C([O-])=O)O | ||
| + | * inchi key: | ||
| + | ** InChIKey=HHDDCCUIIUWNGJ-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** hydroxypyruvate |
| + | * molecular weight: | ||
| + | ** 103.054 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** β-hydroxypyruvate | ||
| + | ** OH-pyruvate | ||
| + | ** OH-pyr | ||
| + | ** 3-hydroxypyruvate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN0-300]] | ||
| + | * [[GLYCERATE-DEHYDROGENASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN0-305]] | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * CAS : 1113-60-6 |
| − | {{#set: | + | * METABOLIGHTS : MTBLC17180 |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4186339 4186339] | ||
| + | * HMDB : HMDB01352 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00168 C00168] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.3397158.html 3397158] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17180 17180] | ||
| + | * BIGG : hpyr | ||
| + | {{#set: smiles=C(C(=O)C([O-])=O)O}} | ||
| + | {{#set: inchi key=InChIKey=HHDDCCUIIUWNGJ-UHFFFAOYSA-M}} | ||
| + | {{#set: common name=hydroxypyruvate}} | ||
| + | {{#set: molecular weight=103.054 }} | ||
| + | {{#set: common name=β-hydroxypyruvate|OH-pyruvate|OH-pyr|3-hydroxypyruvate}} | ||
| + | {{#set: consumed by=RXN0-300|GLYCERATE-DEHYDROGENASE-RXN}} | ||
| + | {{#set: reversible reaction associated=RXN0-305}} | ||
Revision as of 18:38, 18 March 2018
Contents
Metabolite OH-PYR
- smiles:
- C(C(=O)C([O-])=O)O
- inchi key:
- InChIKey=HHDDCCUIIUWNGJ-UHFFFAOYSA-M
- common name:
- hydroxypyruvate
- molecular weight:
- 103.054
- Synonym(s):
- β-hydroxypyruvate
- OH-pyruvate
- OH-pyr
- 3-hydroxypyruvate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 1113-60-6
- METABOLIGHTS : MTBLC17180
- PUBCHEM:
- HMDB : HMDB01352
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : hpyr
"C(C(=O)C([O-])=O)O" cannot be used as a page name in this wiki.
