Difference between revisions of "Tiso gene 3454"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5846 CPD-5846] == * smiles: ** CC(C)CCCC(C)[CH]4(CC[CH]3(C(C)(CC[CH]2(C(=CC[CH]1(C(C)(C([O-...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYNA1tm GLYNA1tm] == * direction: ** REVERSIBLE * common name: ** Neutral amino acid transporter (...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5846 CPD-5846] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYNA1tm GLYNA1tm] ==
−
* smiles:
+
* direction:
−
** CC(C)CCCC(C)[CH]4(CC[CH]3(C(C)(CC[CH]2(C(=CC[CH]1(C(C)(C([O-])=O)C(CCC(C)12)O))3))4))
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=UQFZKTIHSICSPG-DSHYQQBWSA-M
+
 
* common name:
 
* common name:
−
** 3β-hydroxy-4β-methyl-5α-cholest-7-ene-4α-carboxylate
+
** Neutral amino acid transporter (gly), mitochondrial
−
* molecular weight:
+
−
** 443.688   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 17-(1,5-dimethylhexyl)-3-hydroxy-4,10,13-trimethyl-2,3,4,5,6,9, 10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a] phenanthrene-4-carboxylic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1.0 [[GLY]][c] '''+''' 1.0 [[NA+]][c] '''<=>''' 1.0 [[NA+]][m] '''+''' 1.0 [[GLY]][m]
−
* [[1.1.1.170-RXN]]
+
* With common name(s):
 +
** 1.0 glycine[c] '''+''' 1.0 Na+[c] '''<=>''' 1.0 Na+[m] '''+''' 1.0 glycine[m]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_1764]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145105 21145105]
+
{{#set: common name=Neutral amino acid transporter (gly), mitochondrial}}
−
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_1764}}
−
** [http://www.chemspider.com/Chemical-Structure.20015982.html 20015982]
+
{{#set: in pathway=}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58387 58387]
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
* LIGAND-CPD:
+
{{#set: reconstruction tool=pantograph}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04840 C04840]
+
−
* HMDB : HMDB11662
+
−
{{#set: smiles=CC(C)CCCC(C)[CH]4(CC[CH]3(C(C)(CC[CH]2(C(=CC[CH]1(C(C)(C([O-])=O)C(CCC(C)12)O))3))4))}}
+
−
{{#set: inchi key=InChIKey=UQFZKTIHSICSPG-DSHYQQBWSA-M}}
+
−
{{#set: common name=3&beta;-hydroxy-4&beta;-methyl-5&alpha;-cholest-7-ene-4&alpha;-carboxylate}}
+
−
{{#set: molecular weight=443.688    }}
+
−
{{#set: common name=17-(1,5-dimethylhexyl)-3-hydroxy-4,10,13-trimethyl-2,3,4,5,6,9, 10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a] phenanthrene-4-carboxylic acid}}
+
−
{{#set: consumed or produced by=1.1.1.170-RXN}}
+

Revision as of 18:39, 18 March 2018

Reaction GLYNA1tm

  • direction:
    • REVERSIBLE
  • common name:
    • Neutral amino acid transporter (gly), mitochondrial
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 glycine[c] + 1.0 Na+[c] <=> 1.0 Na+[m] + 1.0 glycine[m]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_3454&oldid=25925"