Difference between revisions of "CPD-236"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2742 CPD-2742] == * smiles: ** C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey=...") |
(Created page with "Category:Gene == Gene Tiso_gene_14398 == * left end position: ** 9687 * transcription direction: ** NEGATIVE * right end position: ** 12413 * centisome position: ** 78.039...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_14398 == |
− | * | + | * left end position: |
− | ** | + | ** 9687 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 12413 |
− | * | + | * centisome position: |
− | ** | + | ** 78.039154 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[KYNURENINE-3-MONOOXYGENASE-RXN]] |
− | * [[ | + | ** in-silico_annotation |
− | * [[ | + | ***automated-name-match |
− | * [[ | + | ** [[pantograph]]-[[esiliculosus]] |
− | + | == Pathways associated == | |
− | + | * [[PWY-7765]] | |
+ | * [[PWY-5651]] | ||
+ | * [[PWY-6309]] | ||
+ | * [[PWY-7717]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=9687}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=12413}} | |
− | + | {{#set: centisome position=78.039154 }} | |
− | + | {{#set: reaction associated=KYNURENINE-3-MONOOXYGENASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-7765|PWY-5651|PWY-6309|PWY-7717}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:40, 18 March 2018
Gene Tiso_gene_14398
- left end position:
- 9687
- transcription direction:
- NEGATIVE
- right end position:
- 12413
- centisome position:
- 78.039154
- Synonym(s):
Reactions associated
- KYNURENINE-3-MONOOXYGENASE-RXN
- in-silico_annotation
- automated-name-match
- pantograph-esiliculosus
- in-silico_annotation