Difference between revisions of "Tiso gene 2365"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15123 RXN-15123] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-236 CPD-236] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15123 RXN-15123] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-236 CPD-236] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/3.5.99 EC-3.5.99]
+
** InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M
 +
* common name:
 +
** gibberellin A29
 +
* molecular weight:
 +
** 347.387   
 
* Synonym(s):
 
* Synonym(s):
 +
** GA29
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CPD-16013]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[2-OXOBUTANOATE]][c] '''+''' 1 [[AMMONIUM]][c]
+
* [[RXN-113]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 2-iminobutanoate[c] '''+''' 1 H+[c] '''+''' 1 H2O[c] '''=>''' 1 2-oxobutanoate[c] '''+''' 1 ammonium[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[HOMOCYSDEGR-PWY]], L-cysteine biosynthesis III (from L-homocysteine): [http://metacyc.org/META/NEW-IMAGE?object=HOMOCYSDEGR-PWY HOMOCYSDEGR-PWY]
+
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
−
* [[ILEUSYN-PWY]], L-isoleucine biosynthesis I (from threonine): [http://metacyc.org/META/NEW-IMAGE?object=ILEUSYN-PWY ILEUSYN-PWY]
+
−
** '''7''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-701]], L-methionine degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-701 PWY-701]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-5437]], L-threonine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5437 PWY-5437]
+
−
** '''3''' reactions found over '''6''' reactions in the full pathway
+
−
* [[PWY-5826]], hypoglycin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5826 PWY-5826]
+
−
** '''4''' reactions found over '''14''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: ec number=EC-3.5.99}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200412 25200412]
−
{{#set: in pathway=HOMOCYSDEGR-PWY|ILEUSYN-PWY|PWY-701|PWY-5437|PWY-5826}}
+
* CHEBI:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28040 28040]
−
{{#set: reconstruction tool=pathwaytools}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C06096 C06096]
 +
{{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
 +
{{#set: inchi key=InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M}}
 +
{{#set: common name=gibberellin A29}}
 +
{{#set: molecular weight=347.387    }}
 +
{{#set: common name=GA29}}
 +
{{#set: produced by=RXN-113}}

Revision as of 18:40, 18 March 2018

Metabolite CPD-236

  • smiles:
    • C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))
  • inchi key:
    • InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M
  • common name:
    • gibberellin A29
  • molecular weight:
    • 347.387
  • Synonym(s):
    • GA29

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_2365&oldid=26008"