Difference between revisions of "RNASE-II-DEGRADATION-SUBSTRATE-MRNA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_14398 == * left end position: ** 9687 * transcription direction: ** NEGATIVE * right end position: ** 12413 * centisome position: ** 78.039...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15688 CPD-15688] == * smiles: ** CCCCCCC=CC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_14398 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15688 CPD-15688] ==
−
* left end position:
+
* smiles:
−
** 9687
+
** CCCCCCC=CC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=ARQUZFJQPYWSSL-NBLUIMTHSA-J
−
* right end position:
+
* common name:
−
** 12413
+
** 3-cis, 5-trans-dodecadienoyl-CoA
−
* centisome position:
+
* molecular weight:
−
** 78.039154    
+
** 941.776    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[KYNURENINE-3-MONOOXYGENASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
* [[RXN-14799]]
−
***automated-name-match
+
== Reaction(s) of unknown directionality ==
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways associated ==
+
−
* [[PWY-7765]]
+
−
* [[PWY-5651]]
+
−
* [[PWY-6309]]
+
−
* [[PWY-7717]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=9687}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657300 90657300]
−
{{#set: right end position=12413}}
+
{{#set: smiles=CCCCCCC=CC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
{{#set: centisome position=78.039154    }}
+
{{#set: inchi key=InChIKey=ARQUZFJQPYWSSL-NBLUIMTHSA-J}}
−
{{#set: reaction associated=KYNURENINE-3-MONOOXYGENASE-RXN}}
+
{{#set: common name=3-cis, 5-trans-dodecadienoyl-CoA}}
−
{{#set: pathway associated=PWY-7765|PWY-5651|PWY-6309|PWY-7717}}
+
{{#set: molecular weight=941.776    }}
 +
{{#set: produced by=RXN-14799}}

Revision as of 18:40, 18 March 2018

Metabolite CPD-15688

  • smiles:
    • CCCCCCC=CC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=ARQUZFJQPYWSSL-NBLUIMTHSA-J
  • common name:
    • 3-cis, 5-trans-dodecadienoyl-CoA
  • molecular weight:
    • 941.776
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RNASE-II-DEGRADATION-SUBSTRATE-MRNA&oldid=26018"