Difference between revisions of "Tiso gene 16906"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19202 CPD-19202] == * smiles: ** C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C(N...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Malonyl-acp-methyl-ester Malonyl-acp-methyl-ester] == * common name: ** a malonyl-[acp] methyl...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19202 CPD-19202] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Malonyl-acp-methyl-ester Malonyl-acp-methyl-ester] ==
−
* smiles:
+
−
** C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C(NC(CO)C(=O)NC(C([O-])=O)C2(C=CC(O)=CC=2))=O)C3(C=CC(O)=CC=3)
+
−
* inchi key:
+
−
** InChIKey=ZHBGOAMEFNAJGS-JUCVYKANSA-O
+
 
* common name:
 
* common name:
−
** L-4-hydroxyphenylglycine-L-arginyl-D-4-hydroxyphenylglycine-L-seryl-L 4-hydroxyphenylglycine
+
** a malonyl-[acp] methyl ester
−
* molecular weight:
+
−
** 709.734   
+
 
* Synonym(s):
 
* Synonym(s):
−
** L-pHPG-L-Arg-D-pHPG-L-Ser-L-pHPG
+
** a malonyl-[acyl-carrier protein] methyl ester
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-17832]]
+
* [[RXN-11474]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C(NC(CO)C(=O)NC(C([O-])=O)C2(C=CC(O)=CC=2))=O)C3(C=CC(O)=CC=3)}}
+
{{#set: common name=a malonyl-[acp] methyl ester}}
−
{{#set: inchi key=InChIKey=ZHBGOAMEFNAJGS-JUCVYKANSA-O}}
+
{{#set: common name=a malonyl-[acyl-carrier protein] methyl ester}}
−
{{#set: common name=L-4-hydroxyphenylglycine-L-arginyl-D-4-hydroxyphenylglycine-L-seryl-L 4-hydroxyphenylglycine}}
+
{{#set: consumed by=RXN-11474}}
−
{{#set: molecular weight=709.734    }}
+
−
{{#set: common name=L-pHPG-L-Arg-D-pHPG-L-Ser-L-pHPG}}
+
−
{{#set: consumed by=RXN-17832}}
+

Revision as of 18:40, 18 March 2018

Metabolite Malonyl-acp-methyl-ester

  • common name:
    • a malonyl-[acp] methyl ester
  • Synonym(s):
    • a malonyl-[acyl-carrier protein] methyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a malonyl-[acp] methyl ester" cannot be used as a page name in this wiki.
"a malonyl-[acyl-carrier protein] methyl ester" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_16906&oldid=26046"