Difference between revisions of "2-ISOPROPYLMALATESYN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12440 RXN-12440] == * direction: ** LEFT-TO-RIGHT * common name: ** ascorbate_peroxidase * ec n...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10269 CPD-10269] == * smiles: ** CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12440 RXN-12440] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10269 CPD-10269] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=QBYOCCWNZAOZTL-MDMKAECGSA-J
 
* common name:
 
* common name:
−
** ascorbate_peroxidase
+
** palmitoleoyl-CoA
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.11.1.11 EC-1.11.1.11]
+
** 999.899   
 
* Synonym(s):
 
* Synonym(s):
 +
** 16:1-delta9-CoA
 +
** 9z-hexadecenoyl-CoA
 +
** cis-9-hexadecenoyl-CoA
 +
** palmitoleoyl coenzyme A
 +
** (9Z)-hexadec-9-enoyl-CoA
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-17019]]
−
** 2 [[ASCORBATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c] '''=>''' 1 [[ASCORBATE]][c] '''+''' 1 [[L-DEHYDRO-ASCORBATE]][c] '''+''' 2 [[WATER]][c]
+
* [[RXN-17008]]
−
* With common name(s):
+
* [[RXN-17009]]
−
** 2 L-ascorbate[c] '''+''' 1 H+[c] '''+''' 1 hydrogen peroxide[c] '''=>''' 1 L-ascorbate[c] '''+''' 1 L-dehydro-ascorbate[c] '''+''' 2 H2O[c]
+
* [[RXN-17788]]
−
 
+
== Reaction(s) known to produce the compound ==
−
== Genes associated with this reaction  ==
+
* [[RXN-17787]]
−
Genes have been associated with this reaction based on different elements listed below.
+
* [[RXN0-7248]]
−
* [[Tiso_gene_5435]]
+
== Reaction(s) of unknown directionality ==
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Tiso_gene_16028]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Tiso_gene_15962]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-6959]], L-ascorbate degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6959 PWY-6959]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-6960]], L-ascorbate degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6960 PWY-6960]
+
−
** '''3''' reactions found over '''6''' reactions in the full pathway
+
−
* [[PWY-6961]], L-ascorbate degradation II (bacterial, aerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6961 PWY-6961]
+
−
** '''3''' reactions found over '''8''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=ascorbate_peroxidase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244393 25244393]
−
{{#set: ec number=EC-1.11.1.11}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_5435|Tiso_gene_16028|Tiso_gene_15962}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61540 61540]
−
{{#set: in pathway=PWY-6959|PWY-6960|PWY-6961}}
+
* METABOLIGHTS : MTBLC61540
−
{{#set: reconstruction category=annotation}}
+
{{#set: smiles=CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: inchi key=InChIKey=QBYOCCWNZAOZTL-MDMKAECGSA-J}}
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: common name=palmitoleoyl-CoA}}
 +
{{#set: molecular weight=999.899    }}
 +
{{#set: common name=16:1-delta9-CoA|9z-hexadecenoyl-CoA|cis-9-hexadecenoyl-CoA|palmitoleoyl coenzyme A|(9Z)-hexadec-9-enoyl-CoA}}
 +
{{#set: consumed by=RXN-17019|RXN-17008|RXN-17009|RXN-17788}}
 +
{{#set: produced by=RXN-17787|RXN0-7248}}

Revision as of 18:40, 18 March 2018

Metabolite CPD-10269

  • smiles:
    • CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=QBYOCCWNZAOZTL-MDMKAECGSA-J
  • common name:
    • palmitoleoyl-CoA
  • molecular weight:
    • 999.899
  • Synonym(s):
    • 16:1-delta9-CoA
    • 9z-hexadecenoyl-CoA
    • cis-9-hexadecenoyl-CoA
    • palmitoleoyl coenzyme A
    • (9Z)-hexadec-9-enoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=2-ISOPROPYLMALATESYN-RXN&oldid=26059"