Difference between revisions of "ADP-SUGARS"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15688 CPD-15688] == * smiles: ** CCCCCCC=CC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] == * smiles: ** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] == |
* smiles: | * smiles: | ||
| − | ** CCCCCCC | + | ** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J |
* common name: | * common name: | ||
| − | ** 3- | + | ** 3-oxo-(5Z)-dodecenoyl-CoA |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 957.775 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 3-oxo-12:1-Δ5-CoA | ||
| + | ** 3-oxo-5-cis-dodecenoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-17799]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-17798]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: smiles=CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
| − | + | {{#set: inchi key=InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J}} | |
| − | {{#set: smiles=CCCCCCC | + | {{#set: common name=3-oxo-(5Z)-dodecenoyl-CoA}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: molecular weight=957.775 }} |
| − | {{#set: common name=3- | + | {{#set: common name=3-oxo-12:1-Δ5-CoA|3-oxo-5-cis-dodecenoyl-CoA}} |
| − | {{#set: molecular weight= | + | {{#set: consumed by=RXN-17799}} |
| − | {{#set: produced by=RXN- | + | {{#set: produced by=RXN-17798}} |
Revision as of 18:40, 18 March 2018
Contents
Metabolite CPD-19153
- smiles:
- CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J
- common name:
- 3-oxo-(5Z)-dodecenoyl-CoA
- molecular weight:
- 957.775
- Synonym(s):
- 3-oxo-12:1-Δ5-CoA
- 3-oxo-5-cis-dodecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
