Difference between revisions of "Tiso gene 10754"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE TREHALOSE] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))O * inchi ke...") |
(Created page with "Category:Gene == Gene Tiso_gene_10811 == * left end position: ** 6225 * transcription direction: ** POSITIVE * right end position: ** 7456 * centisome position: ** 54.2341...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_10811 == |
− | * | + | * left end position: |
− | ** | + | ** 6225 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 7456 |
− | * | + | * centisome position: |
− | ** | + | ** 54.234188 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[DEOXYHYPUSINE-MONOOXYGENASE-RXN]] |
− | == | + | ** in-silico_annotation |
− | * [[ | + | ***ec-number |
− | + | == Pathways associated == | |
+ | * [[PWY-5905]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=6225}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=7456}} | |
− | + | {{#set: centisome position=54.234188 }} | |
− | + | {{#set: reaction associated=DEOXYHYPUSINE-MONOOXYGENASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-5905}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 18:40, 18 March 2018
Gene Tiso_gene_10811
- left end position:
- 6225
- transcription direction:
- POSITIVE
- right end position:
- 7456
- centisome position:
- 54.234188
- Synonym(s):
Reactions associated
- DEOXYHYPUSINE-MONOOXYGENASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation