Difference between revisions of "RXN0-6490"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17372 CPD-17372] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O * inchi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-pseudouridine32 tRNA-pseudouridine32] == * common name: ** a pseudouridine32 in tRNA * Syn...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-pseudouridine32 tRNA-pseudouridine32] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a pseudouridine32 in tRNA |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** a tRNA pseudouridine32 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-11842]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a pseudouridine32 in tRNA}} | |
− | + | {{#set: common name=a tRNA pseudouridine32}} | |
− | {{#set: | + | {{#set: produced by=RXN-11842}} |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: | + |
Revision as of 18:41, 18 March 2018
Contents
Metabolite tRNA-pseudouridine32
- common name:
- a pseudouridine32 in tRNA
- Synonym(s):
- a tRNA pseudouridine32