Difference between revisions of "ALPHA-METHYL-5-ALPHA-ERGOSTA"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.63-RXN 2.1.1.63-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** heat_shock_40_kda_pro...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-METHYL-5-ALPHA-ERGOSTA ALPHA-METHYL-5-ALPHA-ERGOSTA] == * smiles: ** CC(C)C(=C)CCC(C)[CH]...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-METHYL-5-ALPHA-ERGOSTA ALPHA-METHYL-5-ALPHA-ERGOSTA] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)C(=C)CCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34)))) |
+ | * inchi key: | ||
+ | ** InChIKey=HLAWVOWADPNAGN-BAHZUFOISA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 4α-methyl-5α-ergosta-8,14,24(28)-trien-3β-ol |
− | + | * molecular weight: | |
− | * | + | ** 410.682 |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** 4α-methyl-5α-ergosta-8,14,24(241)-trien-3β-ol | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-4144]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[OBFOOLor]] | |
− | + | * [[1.14.13.70-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=443237 443237] |
− | + | * CHEBI: | |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30109 30109] | |
− | + | * LIGAND-CPD: | |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11508 C11508] |
− | ** [http://www. | + | * HMDB : HMDB06928 |
− | + | {{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}} | |
− | + | {{#set: inchi key=InChIKey=HLAWVOWADPNAGN-BAHZUFOISA-N}} | |
− | * | + | {{#set: common name=4α-methyl-5α-ergosta-8,14,24(28)-trien-3β-ol}} |
− | ** [http://www. | + | {{#set: molecular weight=410.682 }} |
− | * | + | {{#set: common name=4α-methyl-5α-ergosta-8,14,24(241)-trien-3β-ol}} |
− | + | {{#set: consumed by=RXN-4144}} | |
− | + | {{#set: produced by=OBFOOLor|1.14.13.70-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 18:41, 18 March 2018
Contents
Metabolite ALPHA-METHYL-5-ALPHA-ERGOSTA
- smiles:
- CC(C)C(=C)CCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
- inchi key:
- InChIKey=HLAWVOWADPNAGN-BAHZUFOISA-N
- common name:
- 4α-methyl-5α-ergosta-8,14,24(28)-trien-3β-ol
- molecular weight:
- 410.682
- Synonym(s):
- 4α-methyl-5α-ergosta-8,14,24(241)-trien-3β-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(=C)CCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.