Difference between revisions of "RXN-12720"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P3I P3I] == * smiles: ** [O-]P(OP(=O)(OP([O-])(=O)[O-])[O-])([O-])=O * inchi key: ** InChIKey=U...") |
(Created page with "Category:Gene == Gene Tiso_gene_14774 == * left end position: ** 56 * transcription direction: ** POSITIVE * right end position: ** 5048 * centisome position: ** 1.0309278...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_14774 == |
− | * | + | * left end position: |
− | ** | + | ** 56 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 5048 |
− | * | + | * centisome position: |
− | ** | + | ** 1.0309278 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[RXN-11109]] | |
− | * [[ | + | ** in-silico_annotation |
− | * | + | ***automated-name-match |
− | * [[ | + | ** [[pantograph]]-[[esiliculosus]] |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=56}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=5048}} | |
− | + | {{#set: centisome position=1.0309278 }} | |
− | + | {{#set: reaction associated=RXN-11109}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 18:41, 18 March 2018
Gene Tiso_gene_14774
- left end position:
- 56
- transcription direction:
- POSITIVE
- right end position:
- 5048
- centisome position:
- 1.0309278
- Synonym(s):
Reactions associated
- RXN-11109
- in-silico_annotation
- automated-name-match
- pantograph-esiliculosus
- in-silico_annotation