Difference between revisions of "Tiso gene 18559"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] == * smiles: ** C(=O)(C1(O)(C=CCCC(=O)1))[O-] * inchi key: ** InChIKey=WEZ...") |
(Created page with "Category:Gene == Gene Tiso_gene_2100 == * Synonym(s): == Reactions associated == * 3.1.3.46-RXN ** experimental_annotation ***automated-name-match ** pantograph-[...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_2100 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[3.1.3.46-RXN]] | |
− | * [[RXN- | + | ** experimental_annotation |
− | == | + | ***automated-name-match |
+ | ** [[pantograph]]-[[athaliana]] | ||
+ | * [[6-PHOSPHOFRUCTO-2-KINASE-RXN]] | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[athaliana]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY66-423]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=3.1.3.46-RXN|6-PHOSPHOFRUCTO-2-KINASE-RXN}} | |
− | + | {{#set: pathway associated=PWY66-423}} | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 19:41, 18 March 2018
Gene Tiso_gene_2100
- Synonym(s):
Reactions associated
- 3.1.3.46-RXN
- experimental_annotation
- automated-name-match
- pantograph-athaliana
- experimental_annotation
- 6-PHOSPHOFRUCTO-2-KINASE-RXN
- experimental_annotation
- ec-number
- pantograph-athaliana
- experimental_annotation